C26H34FN3O5 — CID 66605718
8-O-tert-butyl 14-O-ethyl 12-cyclopropyl-18-fluoro-15-oxo-2,8,12-triazatetracyclo[8.8.0.02,6.011,16]octadeca-1(18),10,16-triene-8,14-dicarboxylate (PubChem CID 66605718) has the molecular formula C26H34FN3O5 and a molecular weight of 487.57 g/mol. Its IUPAC name is 8-O-tert-butyl 14-O-ethyl 12-cyclopropyl-18-fluoro-15-oxo-2,8,12-triazatetracyclo[8.8.0.02,6.011,16]octadeca-1(18),10,16-triene-8,14-dicarboxylate.
| Compound Name | 8-O-tert-butyl 14-O-ethyl 12-cyclopropyl-18-fluoro-15-oxo-2,8,12-triazatetracyclo[8.8.0.02,6.011,16]octadeca-1(18),10,16-triene-8,14-dicarboxylate |
|---|---|
| PubChem CID | 66605718 |
| Molecular Formula | C26H34FN3O5 |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 8-O-tert-butyl 14-O-ethyl 12-cyclopropyl-18-fluoro-15-oxo-2,8,12-triazatetracyclo[8.8.0.02,6.011,16]octadeca-1(18),10,16-triene-8,14-dicarboxylate |
| SMILES | CCOC(=O)C1CN(C2CC2)c2c(cc(F)c3c2CN(C(=O)OC(C)(C)C)CC2CCCN32)C1=O |
| InChI | InChI=1S/C26H34FN3O5/c1-5-34-24(32)19-14-30(15-8-9-15)21-17(23(19)31)11-20(27)22-18(21)13-28(25(33)35-26(2,3)4)12-16-7-6-10-29(16)22/h11,15-16,19H,5-10,12-14H2,1-4H3 |
| InChIKey | YGOOWJZGMRMPHB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|