C13H23N3O3 — CID 118114407
tert-butyl 3-(2-oxoimidazolidin-1-yl)piperidine-1-carboxylate (PubChem CID 118114407) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is tert-butyl 3-(2-oxoimidazolidin-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-oxoimidazolidin-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118114407 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | tert-butyl 3-(2-oxoimidazolidin-1-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(N2CCNC2=O)C1 |
| InChI | InChI=1S/C13H23N3O3/c1-13(2,3)19-12(18)15-7-4-5-10(9-15)16-8-6-14-11(16)17/h10H,4-9H2,1-3H3,(H,14,17) |
| InChIKey | HPWXGNGPTYKBGV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |