C16H26N2O4 — CID 138622117
tert-butyl (3S)-3-[(3S,4S)-3,4-dimethyl-2,5-dioxopyrrolidin-1-yl]piperidine-1-carboxylate (PubChem CID 138622117) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(3S,4S)-3,4-dimethyl-2,5-dioxopyrrolidin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(3S,4S)-3,4-dimethyl-2,5-dioxopyrrolidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 138622117 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | tert-butyl (3S)-3-[(3S,4S)-3,4-dimethyl-2,5-dioxopyrrolidin-1-yl]piperidine-1-carboxylate |
| SMILES | C[C@@H]1C(=O)N([C@H]2CCCN(C(=O)OC(C)(C)C)C2)C(=O)[C@H]1C |
| InChI | InChI=1S/C16H26N2O4/c1-10-11(2)14(20)18(13(10)19)12-7-6-8-17(9-12)15(21)22-16(3,4)5/h10-12H,6-9H2,1-5H3/t10-,11-,12-/m0/s1 |
| InChIKey | YIHCDCHQYGNVTH-SRVKXCTJSA-N |
| XLogP | 2.03 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|