C19H22BrFN2O4 — CID 46159279
ethyl 1-[1-(4-bromo-2-fluorophenyl)-2-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate (PubChem CID 46159279) has the molecular formula C19H22BrFN2O4 and a molecular weight of 441.30 g/mol. Its IUPAC name is ethyl 1-[1-(4-bromo-2-fluorophenyl)-2-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[1-(4-bromo-2-fluorophenyl)-2-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 46159279 |
| Molecular Formula | C19H22BrFN2O4 |
| Molecular Weight | 441.30 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | ethyl 1-[1-(4-bromo-2-fluorophenyl)-2-oxopyrrolidine-3-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)C2CCN(c3ccc(Br)cc3F)C2=O)C1 |
| InChI | InChI=1S/C19H22BrFN2O4/c1-2-27-19(26)12-4-3-8-22(11-12)17(24)14-7-9-23(18(14)25)16-6-5-13(20)10-15(16)21/h5-6,10,12,14H,2-4,7-9,11H2,1H3 |
| InChIKey | SPXQQEJCXTYCLU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|