C19H23FN2O4 — CID 43840943
ethyl 1-[1-(2-fluoro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-3-carboxylate (PubChem CID 43840943) has the molecular formula C19H23FN2O4 and a molecular weight of 362.40 g/mol. Its IUPAC name is ethyl 1-[1-(2-fluoro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[1-(2-fluoro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 43840943 |
| Molecular Formula | C19H23FN2O4 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | ethyl 1-[1-(2-fluoro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C2CC(=O)N(c3ccc(C)cc3F)C2=O)C1 |
| InChI | InChI=1S/C19H23FN2O4/c1-3-26-19(25)13-5-4-8-21(11-13)16-10-17(23)22(18(16)24)15-7-6-12(2)9-14(15)20/h6-7,9,13,16H,3-5,8,10-11H2,1-2H3 |
| InChIKey | DTSTWZLWULCVHJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|