C19H21F3N2O4 — CID 17324682
ethyl 1-[2,5-dioxo-1-[2-(trifluoromethyl)phenyl]pyrrolidin-3-yl]piperidine-3-carboxylate (PubChem CID 17324682) has the molecular formula C19H21F3N2O4 and a molecular weight of 398.38 g/mol. Its IUPAC name is ethyl 1-[2,5-dioxo-1-[2-(trifluoromethyl)phenyl]pyrrolidin-3-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2,5-dioxo-1-[2-(trifluoromethyl)phenyl]pyrrolidin-3-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 17324682 |
| Molecular Formula | C19H21F3N2O4 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | ethyl 1-[2,5-dioxo-1-[2-(trifluoromethyl)phenyl]pyrrolidin-3-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C2CC(=O)N(c3ccccc3C(F)(F)F)C2=O)C1 |
| InChI | InChI=1S/C19H21F3N2O4/c1-2-28-18(27)12-6-5-9-23(11-12)15-10-16(25)24(17(15)26)14-8-4-3-7-13(14)19(20,21)22/h3-4,7-8,12,15H,2,5-6,9-11H2,1H3 |
| InChIKey | BFPLSOZROXFXCI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|