C22H24N2O4 — CID 3429862
ethyl 1-(1-naphthalen-2-yl-2,5-dioxopyrrolidin-3-yl)piperidine-3-carboxylate (PubChem CID 3429862) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is ethyl 1-(1-naphthalen-2-yl-2,5-dioxopyrrolidin-3-yl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(1-naphthalen-2-yl-2,5-dioxopyrrolidin-3-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 3429862 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | ethyl 1-(1-naphthalen-2-yl-2,5-dioxopyrrolidin-3-yl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C2CC(=O)N(c3ccc4ccccc4c3)C2=O)C1 |
| InChI | InChI=1S/C22H24N2O4/c1-2-28-22(27)17-8-5-11-23(14-17)19-13-20(25)24(21(19)26)18-10-9-15-6-3-4-7-16(15)12-18/h3-4,6-7,9-10,12,17,19H,2,5,8,11,13-14H2,1H3 |
| InChIKey | VLHGUGLVRLTOKI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|