C21H26N2O6 — CID 17067496
ethyl 1-[1-(4-ethoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-3-carboxylate (PubChem CID 17067496) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is ethyl 1-[1-(4-ethoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[1-(4-ethoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 17067496 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | ethyl 1-[1-(4-ethoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N3CCCC(C(=O)OCC)C3)C2=O)cc1 |
| InChI | InChI=1S/C21H26N2O6/c1-3-28-20(26)14-7-9-16(10-8-14)23-18(24)12-17(19(23)25)22-11-5-6-15(13-22)21(27)29-4-2/h7-10,15,17H,3-6,11-13H2,1-2H3 |
| InChIKey | IEUZTGZRGCMFQL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|