C17H20N2O5 — CID 2877522
ethyl 4-(3-morpholin-4-yl-2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 2877522) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is ethyl 4-(3-morpholin-4-yl-2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | ethyl 4-(3-morpholin-4-yl-2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 2877522 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | ethyl 4-(3-morpholin-4-yl-2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N3CCOCC3)C2=O)cc1 |
| InChI | InChI=1S/C17H20N2O5/c1-2-24-17(22)12-3-5-13(6-4-12)19-15(20)11-14(16(19)21)18-7-9-23-10-8-18/h3-6,14H,2,7-11H2,1H3 |
| InChIKey | MZCXRNNITLKBTM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|