C23H20Cl2N2O6 — CID 23099156
[2-(2,4-dichlorophenyl)-2-oxoethyl] 4-(3-morpholin-4-yl-2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 23099156) has the molecular formula C23H20Cl2N2O6 and a molecular weight of 491.33 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-(3-morpholin-4-yl-2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-(3-morpholin-4-yl-2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 23099156 |
| Molecular Formula | C23H20Cl2N2O6 |
| Molecular Weight | 491.33 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-(3-morpholin-4-yl-2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(OCC(=O)c1ccc(Cl)cc1Cl)c1ccc(N2C(=O)CC(N3CCOCC3)C2=O)cc1 |
| InChI | InChI=1S/C23H20Cl2N2O6/c24-15-3-6-17(18(25)11-15)20(28)13-33-23(31)14-1-4-16(5-2-14)27-21(29)12-19(22(27)30)26-7-9-32-10-8-26/h1-6,11,19H,7-10,12-13H2 |
| InChIKey | DHCSZSPJSOVXJK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|