C23H19Cl2NO7S — CID 21167772
[2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[3-(2-ethoxy-2-oxoethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21167772) has the molecular formula C23H19Cl2NO7S and a molecular weight of 524.38 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[3-(2-ethoxy-2-oxoethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[3-(2-ethoxy-2-oxoethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21167772 |
| Molecular Formula | C23H19Cl2NO7S |
| Molecular Weight | 524.38 g/mol |
| Exact Mass | 523.03 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[3-(2-ethoxy-2-oxoethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)CSC1CC(=O)N(c2ccc(C(=O)OCC(=O)c3ccc(Cl)cc3Cl)cc2)C1=O |
| InChI | InChI=1S/C23H19Cl2NO7S/c1-2-32-21(29)12-34-19-10-20(28)26(22(19)30)15-6-3-13(4-7-15)23(31)33-11-18(27)16-8-5-14(24)9-17(16)25/h3-9,19H,2,10-12H2,1H3 |
| InChIKey | IVGNKMWZDLTHGR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|