C14H14BrNO4S — CID 51568637
ethyl 2-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetate (PubChem CID 51568637) has the molecular formula C14H14BrNO4S and a molecular weight of 372.24 g/mol. Its IUPAC name is ethyl 2-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetate.
| Compound Name | ethyl 2-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetate |
|---|---|
| PubChem CID | 51568637 |
| Molecular Formula | C14H14BrNO4S |
| Molecular Weight | 372.24 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | ethyl 2-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetate |
| SMILES | CCOC(=O)CS[C@@H]1CC(=O)N(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C14H14BrNO4S/c1-2-20-13(18)8-21-11-7-12(17)16(14(11)19)10-5-3-9(15)4-6-10/h3-6,11H,2,7-8H2,1H3/t11-/m1/s1 |
| InChIKey | VLTBLBWCLUYPMJ-LLVKDONJSA-N |
| XLogP | 2.38 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|