C14H16BrN2O4+ — CID 6966599
[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-(2-ethoxy-2-oxoethyl)azanium (PubChem CID 6966599) has the molecular formula C14H16BrN2O4+ and a molecular weight of 356.20 g/mol. Its IUPAC name is [(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-(2-ethoxy-2-oxoethyl)azanium.
| Compound Name | [(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-(2-ethoxy-2-oxoethyl)azanium |
|---|---|
| PubChem CID | 6966599 |
| Molecular Formula | C14H16BrN2O4+ |
| Molecular Weight | 356.20 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | [(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-(2-ethoxy-2-oxoethyl)azanium |
| SMILES | CCOC(=O)C[NH2+][C@@H]1CC(=O)N(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C14H15BrN2O4/c1-2-21-13(19)8-16-11-7-12(18)17(14(11)20)10-5-3-9(15)4-6-10/h3-6,11,16H,2,7-8H2,1H3/p+1/t11-/m1/s1 |
| InChIKey | YJOIOCUBFVNLPP-LLVKDONJSA-O |
| XLogP | 0.21 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.20 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|