C20H23N2O3+ — CID 6944402
[(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(2-phenylethyl)azanium (PubChem CID 6944402) has the molecular formula C20H23N2O3+ and a molecular weight of 339.42 g/mol. Its IUPAC name is [(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(2-phenylethyl)azanium.
| Compound Name | [(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(2-phenylethyl)azanium |
|---|---|
| PubChem CID | 6944402 |
| Molecular Formula | C20H23N2O3+ |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | [(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(2-phenylethyl)azanium |
| SMILES | CCOc1ccc(N2C(=O)C[C@@H]([NH2+]CCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C20H22N2O3/c1-2-25-17-10-8-16(9-11-17)22-19(23)14-18(20(22)24)21-13-12-15-6-4-3-5-7-15/h3-11,18,21H,2,12-14H2,1H3/p+1/t18-/m1/s1 |
| InChIKey | ZYJWUGQALZFVEX-GOSISDBHSA-O |
| XLogP | 1.52 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|