C20H31N3O3+2 — CID 7380591
[(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-methylpiperidin-1-ium-1-yl)ethyl]azanium (PubChem CID 7380591) has the molecular formula C20H31N3O3+2 and a molecular weight of 361.49 g/mol. Its IUPAC name is [(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-methylpiperidin-1-ium-1-yl)ethyl]azanium.
| Compound Name | [(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-methylpiperidin-1-ium-1-yl)ethyl]azanium |
|---|---|
| PubChem CID | 7380591 |
| Molecular Formula | C20H31N3O3+2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | [(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-methylpiperidin-1-ium-1-yl)ethyl]azanium |
| SMILES | CCOc1ccc(N2C(=O)C[C@@H]([NH2+]CC[NH+]3CCC(C)CC3)C2=O)cc1 |
| InChI | InChI=1S/C20H29N3O3/c1-3-26-17-6-4-16(5-7-17)23-19(24)14-18(20(23)25)21-10-13-22-11-8-15(2)9-12-22/h4-7,15,18,21H,3,8-14H2,1-2H3/p+2/t18-/m1/s1 |
| InChIKey | YZKGQBZYRBGZEF-GOSISDBHSA-P |
| XLogP | -0.40 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|