C18H28FN4O2+3 — CID 7203847
[(3S)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-[3-(4-methylpiperazine-1,4-diium-1-yl)propyl]azanium (PubChem CID 7203847) has the molecular formula C18H28FN4O2+3 and a molecular weight of 351.45 g/mol. Its IUPAC name is [(3S)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-[3-(4-methylpiperazine-1,4-diium-1-yl)propyl]azanium.
| Compound Name | [(3S)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-[3-(4-methylpiperazine-1,4-diium-1-yl)propyl]azanium |
|---|---|
| PubChem CID | 7203847 |
| Molecular Formula | C18H28FN4O2+3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | [(3S)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-[3-(4-methylpiperazine-1,4-diium-1-yl)propyl]azanium |
| SMILES | C[NH+]1CC[NH+](CCC[NH2+][C@H]2CC(=O)N(c3ccc(F)cc3)C2=O)CC1 |
| InChI | InChI=1S/C18H25FN4O2/c1-21-9-11-22(12-10-21)8-2-7-20-16-13-17(24)23(18(16)25)15-5-3-14(19)4-6-15/h3-6,16,20H,2,7-13H2,1H3/p+3/t16-/m0/s1 |
| InChIKey | KJMKQEKDYWWRNS-INIZCTEOSA-Q |
| XLogP | -3.18 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|