C23H28FN3O3+2 — CID 7348439
(3R)-1-(4-fluorophenyl)-3-[4-[2-(4-methoxyphenyl)ethyl]piperazine-1,4-diium-1-yl]pyrrolidine-2,5-dione (PubChem CID 7348439) has the molecular formula C23H28FN3O3+2 and a molecular weight of 413.49 g/mol. Its IUPAC name is (3R)-1-(4-fluorophenyl)-3-[4-[2-(4-methoxyphenyl)ethyl]piperazine-1,4-diium-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-fluorophenyl)-3-[4-[2-(4-methoxyphenyl)ethyl]piperazine-1,4-diium-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7348439 |
| Molecular Formula | C23H28FN3O3+2 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (3R)-1-(4-fluorophenyl)-3-[4-[2-(4-methoxyphenyl)ethyl]piperazine-1,4-diium-1-yl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(CC[NH+]2CC[NH+]([C@@H]3CC(=O)N(c4ccc(F)cc4)C3=O)CC2)cc1 |
| InChI | InChI=1S/C23H26FN3O3/c1-30-20-8-2-17(3-9-20)10-11-25-12-14-26(15-13-25)21-16-22(28)27(23(21)29)19-6-4-18(24)5-7-19/h2-9,21H,10-16H2,1H3/p+2/t21-/m1/s1 |
| InChIKey | OYYPQKRJONCDGI-OAQYLSRUSA-P |
| XLogP | -0.51 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|