C18H27N3O2+2 — CID 2242263
(3S)-1-(4-ethylphenyl)-3-(4-ethylpiperazine-1,4-diium-1-yl)pyrrolidine-2,5-dione (PubChem CID 2242263) has the molecular formula C18H27N3O2+2 and a molecular weight of 317.43 g/mol. Its IUPAC name is (3S)-1-(4-ethylphenyl)-3-(4-ethylpiperazine-1,4-diium-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-ethylphenyl)-3-(4-ethylpiperazine-1,4-diium-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2242263 |
| Molecular Formula | C18H27N3O2+2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | (3S)-1-(4-ethylphenyl)-3-(4-ethylpiperazine-1,4-diium-1-yl)pyrrolidine-2,5-dione |
| SMILES | CCc1ccc(N2C(=O)C[C@H]([NH+]3CC[NH+](CC)CC3)C2=O)cc1 |
| InChI | InChI=1S/C18H25N3O2/c1-3-14-5-7-15(8-6-14)21-17(22)13-16(18(21)23)20-11-9-19(4-2)10-12-20/h5-8,16H,3-4,9-13H2,1-2H3/p+2/t16-/m0/s1 |
| InChIKey | FPGJNNABNNTHDU-INIZCTEOSA-P |
| XLogP | -1.32 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|