C15H20IN3O2+2 — CID 7107917
(3R)-1-(4-iodophenyl)-3-(4-methylpiperazine-1,4-diium-1-yl)pyrrolidine-2,5-dione (PubChem CID 7107917) has the molecular formula C15H20IN3O2+2 and a molecular weight of 401.25 g/mol. Its IUPAC name is (3R)-1-(4-iodophenyl)-3-(4-methylpiperazine-1,4-diium-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-iodophenyl)-3-(4-methylpiperazine-1,4-diium-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7107917 |
| Molecular Formula | C15H20IN3O2+2 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | (3R)-1-(4-iodophenyl)-3-(4-methylpiperazine-1,4-diium-1-yl)pyrrolidine-2,5-dione |
| SMILES | C[NH+]1CC[NH+]([C@@H]2CC(=O)N(c3ccc(I)cc3)C2=O)CC1 |
| InChI | InChI=1S/C15H18IN3O2/c1-17-6-8-18(9-7-17)13-10-14(20)19(15(13)21)12-4-2-11(16)3-5-12/h2-5,13H,6-10H2,1H3/p+2/t13-/m1/s1 |
| InChIKey | JOGOAZLBKWYTFG-CYBMUJFWSA-P |
| XLogP | -1.66 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|