C22H24IN3O4+2 — CID 7107910
(3R)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-1-(4-iodophenyl)pyrrolidine-2,5-dione (PubChem CID 7107910) has the molecular formula C22H24IN3O4+2 and a molecular weight of 521.36 g/mol. Its IUPAC name is (3R)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-1-(4-iodophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-1-(4-iodophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7107910 |
| Molecular Formula | C22H24IN3O4+2 |
| Molecular Weight | 521.36 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | (3R)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-1-(4-iodophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H]([NH+]2CC[NH+](Cc3ccc4c(c3)OCO4)CC2)C(=O)N1c1ccc(I)cc1 |
| InChI | InChI=1S/C22H22IN3O4/c23-16-2-4-17(5-3-16)26-21(27)12-18(22(26)28)25-9-7-24(8-10-25)13-15-1-6-19-20(11-15)30-14-29-19/h1-6,11,18H,7-10,12-14H2/p+2/t18-/m1/s1 |
| InChIKey | QPPXQBDTYLQUMB-GOSISDBHSA-P |
| XLogP | -0.36 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.36 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|