C21H21BrN3O4+ — CID 6975790
(3R)-3-[4-(1,3-benzodioxol-5-yl)piperazin-1-ium-1-yl]-1-(4-bromophenyl)pyrrolidine-2,5-dione (PubChem CID 6975790) has the molecular formula C21H21BrN3O4+ and a molecular weight of 459.32 g/mol. Its IUPAC name is (3R)-3-[4-(1,3-benzodioxol-5-yl)piperazin-1-ium-1-yl]-1-(4-bromophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(1,3-benzodioxol-5-yl)piperazin-1-ium-1-yl]-1-(4-bromophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6975790 |
| Molecular Formula | C21H21BrN3O4+ |
| Molecular Weight | 459.32 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | (3R)-3-[4-(1,3-benzodioxol-5-yl)piperazin-1-ium-1-yl]-1-(4-bromophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H]([NH+]2CCN(c3ccc4c(c3)OCO4)CC2)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H20BrN3O4/c22-14-1-3-15(4-2-14)25-20(26)12-17(21(25)27)24-9-7-23(8-10-24)16-5-6-18-19(11-16)29-13-28-18/h1-6,11,17H,7-10,12-13H2/p+1/t17-/m1/s1 |
| InChIKey | UUPDXTRFTNESQH-QGZVFWFLSA-O |
| XLogP | 1.21 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|