C15H17BrN3O3+ — CID 6965554
4-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-4-ium-1-carbaldehyde (PubChem CID 6965554) has the molecular formula C15H17BrN3O3+ and a molecular weight of 367.22 g/mol. Its IUPAC name is 4-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-4-ium-1-carbaldehyde.
| Compound Name | 4-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-4-ium-1-carbaldehyde |
|---|---|
| PubChem CID | 6965554 |
| Molecular Formula | C15H17BrN3O3+ |
| Molecular Weight | 367.22 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 4-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-4-ium-1-carbaldehyde |
| SMILES | O=CN1CC[NH+]([C@@H]2CC(=O)N(c3ccc(Br)cc3)C2=O)CC1 |
| InChI | InChI=1S/C15H16BrN3O3/c16-11-1-3-12(4-2-11)19-14(21)9-13(15(19)22)18-7-5-17(10-20)6-8-18/h1-4,10,13H,5-9H2/p+1/t13-/m1/s1 |
| InChIKey | IRTJXHXBIVCVHY-CYBMUJFWSA-O |
| XLogP | -0.56 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.22 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|