C17H22BrN2O2+ — CID 6960770
(3R)-3-(azocan-1-ium-1-yl)-1-(4-bromophenyl)pyrrolidine-2,5-dione (PubChem CID 6960770) has the molecular formula C17H22BrN2O2+ and a molecular weight of 366.28 g/mol. Its IUPAC name is (3R)-3-(azocan-1-ium-1-yl)-1-(4-bromophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(azocan-1-ium-1-yl)-1-(4-bromophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6960770 |
| Molecular Formula | C17H22BrN2O2+ |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | (3R)-3-(azocan-1-ium-1-yl)-1-(4-bromophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H]([NH+]2CCCCCCC2)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H21BrN2O2/c18-13-6-8-14(9-7-13)20-16(21)12-15(17(20)22)19-10-4-2-1-3-5-11-19/h6-9,15H,1-5,10-12H2/p+1/t15-/m1/s1 |
| InChIKey | CHKHBZHCRWKAHF-OAHLLOKOSA-O |
| XLogP | 1.93 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|