C15H18ClN2O2+ — CID 4743399
1-(3-chlorophenyl)-3-piperidin-1-ium-1-ylpyrrolidine-2,5-dione (PubChem CID 4743399) has the molecular formula C15H18ClN2O2+ and a molecular weight of 293.77 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-piperidin-1-ium-1-ylpyrrolidine-2,5-dione.
| Compound Name | 1-(3-chlorophenyl)-3-piperidin-1-ium-1-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 4743399 |
| Molecular Formula | C15H18ClN2O2+ |
| Molecular Weight | 293.77 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 1-(3-chlorophenyl)-3-piperidin-1-ium-1-ylpyrrolidine-2,5-dione |
| SMILES | O=C1CC([NH+]2CCCCC2)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H17ClN2O2/c16-11-5-4-6-12(9-11)18-14(19)10-13(15(18)20)17-7-2-1-3-8-17/h4-6,9,13H,1-3,7-8,10H2/p+1 |
| InChIKey | CBZHGQVJJYXNKI-UHFFFAOYSA-O |
| XLogP | 1.04 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.77 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|