C17H21N2O4+ — CID 7126872
(3R)-3-(azepan-1-ium-1-yl)-1-(1,3-benzodioxol-5-yl)pyrrolidine-2,5-dione (PubChem CID 7126872) has the molecular formula C17H21N2O4+ and a molecular weight of 317.37 g/mol. Its IUPAC name is (3R)-3-(azepan-1-ium-1-yl)-1-(1,3-benzodioxol-5-yl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(azepan-1-ium-1-yl)-1-(1,3-benzodioxol-5-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7126872 |
| Molecular Formula | C17H21N2O4+ |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (3R)-3-(azepan-1-ium-1-yl)-1-(1,3-benzodioxol-5-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H]([NH+]2CCCCCC2)C(=O)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H20N2O4/c20-16-10-13(18-7-3-1-2-4-8-18)17(21)19(16)12-5-6-14-15(9-12)23-11-22-14/h5-6,9,13H,1-4,7-8,10-11H2/p+1/t13-/m1/s1 |
| InChIKey | ZZLVWVGNQGLPLU-CYBMUJFWSA-O |
| XLogP | 0.51 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|