C15H16N2O5 — CID 7126435
(3R)-1-(1,3-benzodioxol-5-yl)-3-morpholin-4-ylpyrrolidine-2,5-dione (PubChem CID 7126435) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is (3R)-1-(1,3-benzodioxol-5-yl)-3-morpholin-4-ylpyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(1,3-benzodioxol-5-yl)-3-morpholin-4-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7126435 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (3R)-1-(1,3-benzodioxol-5-yl)-3-morpholin-4-ylpyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](N2CCOCC2)C(=O)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H16N2O5/c18-14-8-11(16-3-5-20-6-4-16)15(19)17(14)10-1-2-12-13(7-10)22-9-21-12/h1-2,7,11H,3-6,8-9H2/t11-/m1/s1 |
| InChIKey | RSPIIDWDCDJEIP-LLVKDONJSA-N |
| XLogP | 0.38 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|