C22H20N4O4S — CID 5296810
1-(1,3-benzodioxol-5-yl)-3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 5296810) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 5296810 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2CCN(c3nc4ccccc4s3)CC2)C(=O)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H20N4O4S/c27-20-12-16(21(28)26(20)14-5-6-17-18(11-14)30-13-29-17)24-7-9-25(10-8-24)22-23-15-3-1-2-4-19(15)31-22/h1-6,11,16H,7-10,12-13H2 |
| InChIKey | HNADUVBNUWVUMI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|