C23H24N4O3S — CID 2936653
3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-1-(3-ethoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 2936653) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-1-(3-ethoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-1-(3-ethoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2936653 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-1-(3-ethoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | CCOc1cccc(N2C(=O)CC(N3CCN(c4nc5ccccc5s4)CC3)C2=O)c1 |
| InChI | InChI=1S/C23H24N4O3S/c1-2-30-17-7-5-6-16(14-17)27-21(28)15-19(22(27)29)25-10-12-26(13-11-25)23-24-18-8-3-4-9-20(18)31-23/h3-9,14,19H,2,10-13,15H2,1H3 |
| InChIKey | PONFXZVCBOUXAZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|