C24H29N3O3 — CID 2896881
3-[4-(2,5-dimethylphenyl)piperazin-1-yl]-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 2896881) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 3-[4-(2,5-dimethylphenyl)piperazin-1-yl]-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[4-(2,5-dimethylphenyl)piperazin-1-yl]-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2896881 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 3-[4-(2,5-dimethylphenyl)piperazin-1-yl]-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | CCOc1ccc(N2C(=O)CC(N3CCN(c4cc(C)ccc4C)CC3)C2=O)cc1 |
| InChI | InChI=1S/C24H29N3O3/c1-4-30-20-9-7-19(8-10-20)27-23(28)16-22(24(27)29)26-13-11-25(12-14-26)21-15-17(2)5-6-18(21)3/h5-10,15,22H,4,11-14,16H2,1-3H3 |
| InChIKey | BCAIZONUONPPNV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|