C32H32ClN3O6 — CID 21171193
[2-(4-ethoxyphenyl)-2-oxoethyl] 4-[3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21171193) has the molecular formula C32H32ClN3O6 and a molecular weight of 590.08 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-2-oxoethyl] 4-[3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 4-[3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21171193 |
| Molecular Formula | C32H32ClN3O6 |
| Molecular Weight | 590.08 g/mol |
| Exact Mass | 589.20 |
| IUPAC Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 4-[3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOc1ccc(C(=O)COC(=O)c2ccc(N3C(=O)CC(N4CCN(c5cc(Cl)ccc5C)CC4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C32H32ClN3O6/c1-3-41-26-12-7-22(8-13-26)29(37)20-42-32(40)23-5-10-25(11-6-23)36-30(38)19-28(31(36)39)35-16-14-34(15-17-35)27-18-24(33)9-4-21(27)2/h4-13,18,28H,3,14-17,19-20H2,1-2H3 |
| InChIKey | NAMJTPBNQMDCHO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.08 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|