C30H28ClN3O6 — CID 21170219
[2-(4-methoxyphenyl)-2-oxoethyl] 4-[3-[4-(3-chlorophenyl)piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21170219) has the molecular formula C30H28ClN3O6 and a molecular weight of 562.02 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 4-[3-[4-(3-chlorophenyl)piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 4-[3-[4-(3-chlorophenyl)piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21170219 |
| Molecular Formula | C30H28ClN3O6 |
| Molecular Weight | 562.02 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 4-[3-[4-(3-chlorophenyl)piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc(N3C(=O)CC(N4CCN(c5cccc(Cl)c5)CC4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C30H28ClN3O6/c1-39-25-11-7-20(8-12-25)27(35)19-40-30(38)21-5-9-23(10-6-21)34-28(36)18-26(29(34)37)33-15-13-32(14-16-33)24-4-2-3-22(31)17-24/h2-12,17,26H,13-16,18-19H2,1H3 |
| InChIKey | NKLDVKMNBSIKMW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.02 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|