C29H25ClFN3O5 — CID 21169583
[2-(2-chlorophenyl)-2-oxoethyl] 4-[3-[4-(4-fluorophenyl)piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21169583) has the molecular formula C29H25ClFN3O5 and a molecular weight of 549.99 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-2-oxoethyl] 4-[3-[4-(4-fluorophenyl)piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(2-chlorophenyl)-2-oxoethyl] 4-[3-[4-(4-fluorophenyl)piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21169583 |
| Molecular Formula | C29H25ClFN3O5 |
| Molecular Weight | 549.99 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | [2-(2-chlorophenyl)-2-oxoethyl] 4-[3-[4-(4-fluorophenyl)piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | O=C(OCC(=O)c1ccccc1Cl)c1ccc(N2C(=O)CC(N3CCN(c4ccc(F)cc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C29H25ClFN3O5/c30-24-4-2-1-3-23(24)26(35)18-39-29(38)19-5-9-22(10-6-19)34-27(36)17-25(28(34)37)33-15-13-32(14-16-33)21-11-7-20(31)8-12-21/h1-12,25H,13-18H2 |
| InChIKey | DONCQBUOQIVMEO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.99 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|