C30H28FN3O5 — CID 21168223
[2-(4-fluorophenyl)-2-oxoethyl] 4-[3-(4-benzylpiperazin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21168223) has the molecular formula C30H28FN3O5 and a molecular weight of 529.57 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 4-[3-(4-benzylpiperazin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 4-[3-(4-benzylpiperazin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21168223 |
| Molecular Formula | C30H28FN3O5 |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 4-[3-(4-benzylpiperazin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)CC(N3CCN(Cc4ccccc4)CC3)C2=O)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H28FN3O5/c31-24-10-6-22(7-11-24)27(35)20-39-30(38)23-8-12-25(13-9-23)34-28(36)18-26(29(34)37)33-16-14-32(15-17-33)19-21-4-2-1-3-5-21/h1-13,26H,14-20H2 |
| InChIKey | LHOPWCXPHBISSY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|