C26H28N2O6 — CID 23095911
[2-(4-ethoxyphenyl)-2-oxoethyl] 4-(2,5-dioxo-3-piperidin-1-ylpyrrolidin-1-yl)benzoate (PubChem CID 23095911) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-2-oxoethyl] 4-(2,5-dioxo-3-piperidin-1-ylpyrrolidin-1-yl)benzoate.
| Compound Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 4-(2,5-dioxo-3-piperidin-1-ylpyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 23095911 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 4-(2,5-dioxo-3-piperidin-1-ylpyrrolidin-1-yl)benzoate |
| SMILES | CCOc1ccc(C(=O)COC(=O)c2ccc(N3C(=O)CC(N4CCCCC4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C26H28N2O6/c1-2-33-21-12-8-18(9-13-21)23(29)17-34-26(32)19-6-10-20(11-7-19)28-24(30)16-22(25(28)31)27-14-4-3-5-15-27/h6-13,22H,2-5,14-17H2,1H3 |
| InChIKey | FOQKGBHMWWKAFL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|