C29H28N2O6 — CID 23100081
[2-(4-ethoxyphenyl)-2-oxoethyl] 4-[3-[benzyl(methyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23100081) has the molecular formula C29H28N2O6 and a molecular weight of 500.55 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-2-oxoethyl] 4-[3-[benzyl(methyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 4-[3-[benzyl(methyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23100081 |
| Molecular Formula | C29H28N2O6 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 4-[3-[benzyl(methyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOc1ccc(C(=O)COC(=O)c2ccc(N3C(=O)CC(N(C)Cc4ccccc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C29H28N2O6/c1-3-36-24-15-11-21(12-16-24)26(32)19-37-29(35)22-9-13-23(14-10-22)31-27(33)17-25(28(31)34)30(2)18-20-7-5-4-6-8-20/h4-16,25H,3,17-19H2,1-2H3 |
| InChIKey | AMLHHBDSYVWDDR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|