C29H32N2O6 — CID 23100496
[2-(4-ethoxyphenyl)-2-oxoethyl] 4-[3-[2-(cyclohexen-1-yl)ethylamino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23100496) has the molecular formula C29H32N2O6 and a molecular weight of 504.58 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-2-oxoethyl] 4-[3-[2-(cyclohexen-1-yl)ethylamino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 4-[3-[2-(cyclohexen-1-yl)ethylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23100496 |
| Molecular Formula | C29H32N2O6 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 4-[3-[2-(cyclohexen-1-yl)ethylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOc1ccc(C(=O)COC(=O)c2ccc(N3C(=O)CC(NCCC4=CCCCC4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C29H32N2O6/c1-2-36-24-14-10-21(11-15-24)26(32)19-37-29(35)22-8-12-23(13-9-22)31-27(33)18-25(28(31)34)30-17-16-20-6-4-3-5-7-20/h6,8-15,25,30H,2-5,7,16-19H2,1H3 |
| InChIKey | PVZKCRXGWDSIMC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|