C26H29N3O6 — CID 23097797
[2-(4-methylphenyl)-2-oxoethyl] 4-[3-(2-morpholin-4-ylethylamino)-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23097797) has the molecular formula C26H29N3O6 and a molecular weight of 479.53 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 4-[3-(2-morpholin-4-ylethylamino)-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 4-[3-(2-morpholin-4-ylethylamino)-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23097797 |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 4-[3-(2-morpholin-4-ylethylamino)-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccc(N3C(=O)CC(NCCN4CCOCC4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C26H29N3O6/c1-18-2-4-19(5-3-18)23(30)17-35-26(33)20-6-8-21(9-7-20)29-24(31)16-22(25(29)32)27-10-11-28-12-14-34-15-13-28/h2-9,22,27H,10-17H2,1H3 |
| InChIKey | OSUNLOZQVMXYCY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|