C18H25N3O4 — CID 843089
(3R)-1-(4-ethoxyphenyl)-3-(2-morpholin-4-ylethylamino)pyrrolidine-2,5-dione (PubChem CID 843089) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is (3R)-1-(4-ethoxyphenyl)-3-(2-morpholin-4-ylethylamino)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-ethoxyphenyl)-3-(2-morpholin-4-ylethylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 843089 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | (3R)-1-(4-ethoxyphenyl)-3-(2-morpholin-4-ylethylamino)pyrrolidine-2,5-dione |
| SMILES | CCOc1ccc(N2C(=O)C[C@@H](NCCN3CCOCC3)C2=O)cc1 |
| InChI | InChI=1S/C18H25N3O4/c1-2-25-15-5-3-14(4-6-15)21-17(22)13-16(18(21)23)19-7-8-20-9-11-24-12-10-20/h3-6,16,19H,2,7-13H2,1H3/t16-/m1/s1 |
| InChIKey | FWWQGWBQSHLKQX-MRXNPFEDSA-N |
| XLogP | 0.64 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|