C17H22N2O4 — CID 843067
(3R)-1-(4-ethoxyphenyl)-3-[[(2R)-oxolan-2-yl]methylamino]pyrrolidine-2,5-dione (PubChem CID 843067) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is (3R)-1-(4-ethoxyphenyl)-3-[[(2R)-oxolan-2-yl]methylamino]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-ethoxyphenyl)-3-[[(2R)-oxolan-2-yl]methylamino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 843067 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (3R)-1-(4-ethoxyphenyl)-3-[[(2R)-oxolan-2-yl]methylamino]pyrrolidine-2,5-dione |
| SMILES | CCOc1ccc(N2C(=O)C[C@@H](NC[C@H]3CCCO3)C2=O)cc1 |
| InChI | InChI=1S/C17H22N2O4/c1-2-22-13-7-5-12(6-8-13)19-16(20)10-15(17(19)21)18-11-14-4-3-9-23-14/h5-8,14-15,18H,2-4,9-11H2,1H3/t14-,15-/m1/s1 |
| InChIKey | BMWJYAWLINOLDK-HUUCEWRRSA-N |
| XLogP | 1.49 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|