C16H20ClN3O3 — CID 2833582
1-(3-chlorophenyl)-3-(2-morpholin-4-ylethylamino)pyrrolidine-2,5-dione (PubChem CID 2833582) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(2-morpholin-4-ylethylamino)pyrrolidine-2,5-dione.
| Compound Name | 1-(3-chlorophenyl)-3-(2-morpholin-4-ylethylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2833582 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(2-morpholin-4-ylethylamino)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(NCCN2CCOCC2)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H20ClN3O3/c17-12-2-1-3-13(10-12)20-15(21)11-14(16(20)22)18-4-5-19-6-8-23-9-7-19/h1-3,10,14,18H,4-9,11H2 |
| InChIKey | HGQZPQIKPMTYFU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|