C26H31ClN4O4 — CID 17255411
ethyl 4-[3-[3-[4-(3-chlorophenyl)piperazin-1-yl]propylamino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 17255411) has the molecular formula C26H31ClN4O4 and a molecular weight of 499.01 g/mol. Its IUPAC name is ethyl 4-[3-[3-[4-(3-chlorophenyl)piperazin-1-yl]propylamino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[3-[4-(3-chlorophenyl)piperazin-1-yl]propylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 17255411 |
| Molecular Formula | C26H31ClN4O4 |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | ethyl 4-[3-[3-[4-(3-chlorophenyl)piperazin-1-yl]propylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(NCCCN3CCN(c4cccc(Cl)c4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C26H31ClN4O4/c1-2-35-26(34)19-7-9-21(10-8-19)31-24(32)18-23(25(31)33)28-11-4-12-29-13-15-30(16-14-29)22-6-3-5-20(27)17-22/h3,5-10,17,23,28H,2,4,11-16,18H2,1H3 |
| InChIKey | FVUMZPIFCMPKMJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|