C27H34N4O4 — CID 98244664
ethyl 4-[(3S)-3-[3-(4-benzylpiperazin-1-yl)propylamino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 98244664) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is ethyl 4-[(3S)-3-[3-(4-benzylpiperazin-1-yl)propylamino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[(3S)-3-[3-(4-benzylpiperazin-1-yl)propylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 98244664 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | ethyl 4-[(3S)-3-[3-(4-benzylpiperazin-1-yl)propylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C[C@H](NCCCN3CCN(Cc4ccccc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C27H34N4O4/c1-2-35-27(34)22-9-11-23(12-10-22)31-25(32)19-24(26(31)33)28-13-6-14-29-15-17-30(18-16-29)20-21-7-4-3-5-8-21/h3-5,7-12,24,28H,2,6,13-20H2,1H3/t24-/m0/s1 |
| InChIKey | KBGUWUKHCQBUTL-DEOSSOPVSA-N |
| XLogP | 2.29 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|