C27H21Cl3N2O5 — CID 21170117
[2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[3-[2-(3-chlorophenyl)ethylamino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21170117) has the molecular formula C27H21Cl3N2O5 and a molecular weight of 559.83 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[3-[2-(3-chlorophenyl)ethylamino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[3-[2-(3-chlorophenyl)ethylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21170117 |
| Molecular Formula | C27H21Cl3N2O5 |
| Molecular Weight | 559.83 g/mol |
| Exact Mass | 558.05 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[3-[2-(3-chlorophenyl)ethylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | O=C(OCC(=O)c1ccc(Cl)cc1Cl)c1ccc(N2C(=O)CC(NCCc3cccc(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C27H21Cl3N2O5/c28-18-3-1-2-16(12-18)10-11-31-23-14-25(34)32(26(23)35)20-7-4-17(5-8-20)27(36)37-15-24(33)21-9-6-19(29)13-22(21)30/h1-9,12-13,23,31H,10-11,14-15H2 |
| InChIKey | KGGKIEFZFAMIHM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.83 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|