C23H17Cl2N5O5S — CID 21169356
[2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21169356) has the molecular formula C23H17Cl2N5O5S and a molecular weight of 546.39 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21169356 |
| Molecular Formula | C23H17Cl2N5O5S |
| Molecular Weight | 546.39 g/mol |
| Exact Mass | 545.03 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | Nc1cc(N)nc(SC2CC(=O)N(c3ccc(C(=O)OCC(=O)c4ccc(Cl)cc4Cl)cc3)C2=O)n1 |
| InChI | InChI=1S/C23H17Cl2N5O5S/c24-12-3-6-14(15(25)7-12)16(31)10-35-22(34)11-1-4-13(5-2-11)30-20(32)8-17(21(30)33)36-23-28-18(26)9-19(27)29-23/h1-7,9,17H,8,10H2,(H4,26,27,28,29) |
| InChIKey | IKFQMZNIEJOPHX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 158.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|