C25H23Cl2NO5S — CID 21167436
[2-(2,4-dichlorophenyl)-2-oxoethyl] 4-(3-cyclohexylsulfanyl-2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 21167436) has the molecular formula C25H23Cl2NO5S and a molecular weight of 520.43 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-(3-cyclohexylsulfanyl-2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-(3-cyclohexylsulfanyl-2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 21167436 |
| Molecular Formula | C25H23Cl2NO5S |
| Molecular Weight | 520.43 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-(3-cyclohexylsulfanyl-2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(OCC(=O)c1ccc(Cl)cc1Cl)c1ccc(N2C(=O)CC(SC3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C25H23Cl2NO5S/c26-16-8-11-19(20(27)12-16)21(29)14-33-25(32)15-6-9-17(10-7-15)28-23(30)13-22(24(28)31)34-18-4-2-1-3-5-18/h6-12,18,22H,1-5,13-14H2 |
| InChIKey | BMMMQGNUHIFWQV-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.43 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|