C24H11Cl8NO5 — CID 99725604
[2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[(1R,2S,6R,7R)-1,7,8,9,10,10-hexachloro-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate (PubChem CID 99725604) has the molecular formula C24H11Cl8NO5 and a molecular weight of 676.98 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[(1R,2S,6R,7R)-1,7,8,9,10,10-hexachloro-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[(1R,2S,6R,7R)-1,7,8,9,10,10-hexachloro-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
|---|---|
| PubChem CID | 99725604 |
| Molecular Formula | C24H11Cl8NO5 |
| Molecular Weight | 676.98 g/mol |
| Exact Mass | 672.81 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[(1R,2S,6R,7R)-1,7,8,9,10,10-hexachloro-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
| SMILES | O=C(OCC(=O)c1ccc(Cl)cc1Cl)c1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@]2(Cl)C(Cl)=C(Cl)[C@@]3(Cl)C2(Cl)Cl)cc1 |
| InChI | InChI=1S/C24H11Cl8NO5/c25-10-3-6-12(13(26)7-10)14(34)8-38-21(37)9-1-4-11(5-2-9)33-19(35)15-16(20(33)36)23(30)18(28)17(27)22(15,29)24(23,31)32/h1-7,15-16H,8H2/t15-,16+,22-,23-/m1/s1 |
| InChIKey | OXUXKRDARCHQAI-QKCPIRFBSA-N |
| XLogP | 6.98 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.98 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|