C27H19Cl2NO7 — CID 4167760
[2-(2,4-dichlorophenyl)-2-oxoethyl] 1,3-dioxo-2-(4-propoxycarbonylphenyl)isoindole-5-carboxylate (PubChem CID 4167760) has the molecular formula C27H19Cl2NO7 and a molecular weight of 540.36 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 1,3-dioxo-2-(4-propoxycarbonylphenyl)isoindole-5-carboxylate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 1,3-dioxo-2-(4-propoxycarbonylphenyl)isoindole-5-carboxylate |
|---|---|
| PubChem CID | 4167760 |
| Molecular Formula | C27H19Cl2NO7 |
| Molecular Weight | 540.36 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 1,3-dioxo-2-(4-propoxycarbonylphenyl)isoindole-5-carboxylate |
| SMILES | CCCOC(=O)c1ccc(N2C(=O)c3ccc(C(=O)OCC(=O)c4ccc(Cl)cc4Cl)cc3C2=O)cc1 |
| InChI | InChI=1S/C27H19Cl2NO7/c1-2-11-36-26(34)15-3-7-18(8-4-15)30-24(32)19-9-5-16(12-21(19)25(30)33)27(35)37-14-23(31)20-10-6-17(28)13-22(20)29/h3-10,12-13H,2,11,14H2,1H3 |
| InChIKey | FFTVORCVCMZGTR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.36 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|