C26H21NO5 — CID 23823827
[2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 23823827) has the molecular formula C26H21NO5 and a molecular weight of 427.46 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 23823827 |
| Molecular Formula | C26H21NO5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(N2C(=O)c3ccc(C(=O)OCC(=O)c4cc(C)ccc4C)cc3C2=O)cc1 |
| InChI | InChI=1S/C26H21NO5/c1-15-5-9-19(10-6-15)27-24(29)20-11-8-18(13-22(20)25(27)30)26(31)32-14-23(28)21-12-16(2)4-7-17(21)3/h4-13H,14H2,1-3H3 |
| InChIKey | UYSSGCWHPMHOCN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|