C29H21NO5 — CID 23850109
[2-(2,5-dimethylphenyl)-2-oxoethyl] 2-naphthalen-1-yl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 23850109) has the molecular formula C29H21NO5 and a molecular weight of 463.49 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-naphthalen-1-yl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-naphthalen-1-yl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 23850109 |
| Molecular Formula | C29H21NO5 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-naphthalen-1-yl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)c2ccc3c(c2)C(=O)N(c2cccc4ccccc24)C3=O)c1 |
| InChI | InChI=1S/C29H21NO5/c1-17-10-11-18(2)23(14-17)26(31)16-35-29(34)20-12-13-22-24(15-20)28(33)30(27(22)32)25-9-5-7-19-6-3-4-8-21(19)25/h3-15H,16H2,1-2H3 |
| InChIKey | MGRSOCNFJRSSPM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|