C35H31NO6 — CID 3504056
[2-(2,5-dimethylphenyl)-2-oxoethyl] 2-[4-(4-tert-butylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 3504056) has the molecular formula C35H31NO6 and a molecular weight of 561.63 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-[4-(4-tert-butylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-[4-(4-tert-butylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 3504056 |
| Molecular Formula | C35H31NO6 |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-[4-(4-tert-butylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)c2ccc3c(c2)C(=O)N(c2ccc(Oc4ccc(C(C)(C)C)cc4)cc2)C3=O)c1 |
| InChI | InChI=1S/C35H31NO6/c1-21-6-7-22(2)29(18-21)31(37)20-41-34(40)23-8-17-28-30(19-23)33(39)36(32(28)38)25-11-15-27(16-12-25)42-26-13-9-24(10-14-26)35(3,4)5/h6-19H,20H2,1-5H3 |
| InChIKey | ZBXOPDVIIUJLIP-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|